CAS 88352-90-3
:Ethanone, 2-amino-1-(3-furanyl)-, hydrochloride (1:1)
Description:
Ethanone, 2-amino-1-(3-furanyl)-, hydrochloride (1:1), with the CAS number 88352-90-3, is a chemical compound characterized by its structural features that include an ethanone moiety and an amino group attached to a furan ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The furan ring contributes to its aromatic properties, while the amino group can participate in various chemical reactions, including hydrogen bonding and nucleophilic attacks. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its hydrochloride form indicates that it is a salt, which can influence its pharmacokinetics and bioavailability. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation. Safety data sheets should be consulted for information on toxicity and safe handling practices.
Formula:C6H7NO2·ClH
InChI:InChI=1S/C6H7NO2.ClH/c7-3-6(8)5-1-2-9-4-5;/h1-2,4H,3,7H2;1H
InChI key:InChIKey=CHOQKBKQDVRWOT-UHFFFAOYSA-N
SMILES:C(CN)(=O)C=1C=COC1.Cl
Synonyms:- Ethanone, 2-amino-1-(3-furanyl)-, hydrochloride
- Ethanone, 2-amino-1-(3-furanyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
