CAS 883521-30-0
:3,5-Difluoro-2-propoxybenzaldehyde
Description:
3,5-Difluoro-2-propoxybenzaldehyde is an organic compound characterized by the presence of a benzaldehyde functional group, which is a key feature of aromatic aldehydes. The compound contains two fluorine atoms positioned at the 3 and 5 positions of the benzene ring, contributing to its unique reactivity and physical properties. The propoxy group, attached at the 2-position, enhances its solubility in organic solvents and may influence its biological activity. This compound is likely to exhibit polar characteristics due to the presence of the aldehyde and ether functionalities, which can engage in hydrogen bonding. Its fluorinated nature may also impart increased stability and lipophilicity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The presence of fluorine can enhance the compound's metabolic stability and alter its interaction with biological targets. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C10H10F2O2
InChI:InChI=1S/C10H10F2O2/c1-2-3-14-10-7(6-13)4-8(11)5-9(10)12/h4-6H,2-3H2,1H3
InChI key:InChIKey=TZQPVXFIBXSFCB-UHFFFAOYSA-N
SMILES:O(CCC)C1=C(C=O)C=C(F)C=C1F
Synonyms:- 3,5-Difluoro-2-propoxybenzaldehyde
- Benzaldehyde, 3,5-difluoro-2-propoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.