CAS 883521-63-9
:1-(1-cyclopentylpiperidin-3-yl)methanamine
Description:
1-(1-Cyclopentylpiperidin-3-yl)methanamine, identified by its CAS number 883521-63-9, is a chemical compound that belongs to the class of amines. It features a piperidine ring substituted with a cyclopentyl group and a methanamine moiety, contributing to its unique structural characteristics. This compound is typically characterized by its potential biological activity, particularly in the context of pharmacology, where it may interact with various neurotransmitter systems. Its molecular structure suggests it may exhibit properties such as lipophilicity, which can influence its ability to cross biological membranes. Additionally, the presence of both cyclic and aliphatic components in its structure may affect its stability and reactivity. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this nature often demonstrate moderate to high solubility in organic solvents. Overall, 1-(1-cyclopentylpiperidin-3-yl)methanamine is of interest in medicinal chemistry and may serve as a lead compound for further drug development.
Formula:C11H22N2
InChI:InChI=1/C11H22N2/c12-8-10-4-3-7-13(9-10)11-5-1-2-6-11/h10-11H,1-9,12H2
SMILES:C1CCC(C1)N1CCCC(CN)C1
Synonyms:- 3-Piperidinemethanamine, 1-Cyclopentyl-
- 1-(1-Cyclopentylpiperidin-3-yl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.