CAS 883521-80-0
:2-Bromo-N-cyclopentylacetamide
Description:
2-Bromo-N-cyclopentylacetamide is an organic compound characterized by the presence of a bromine atom, a cyclopentyl group, and an acetamide functional group. Its molecular structure features a bromine atom attached to the second carbon of an acetamide, which is further substituted with a cyclopentyl group at the nitrogen atom. This compound is typically a solid at room temperature and is soluble in organic solvents due to its non-polar cyclopentyl moiety. The presence of the bromine atom contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The acetamide functional group imparts some polar characteristics, which can influence its interactions in biological systems. As with many brominated compounds, it may exhibit interesting pharmacological properties, although specific biological activities would require further investigation. Safety precautions should be taken when handling this compound, as brominated substances can be hazardous.
Formula:C7H12BrNO
InChI:InChI=1S/C7H12BrNO/c8-5-7(10)9-6-3-1-2-4-6/h6H,1-5H2,(H,9,10)
InChI key:InChIKey=KVESMOYKDNWRSD-UHFFFAOYSA-N
SMILES:N(C(CBr)=O)C1CCCC1
Synonyms:- Acetamide, 2-bromo-N-cyclopentyl-
- 2-Bromo-N-cyclopentylacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.