CymitQuimica logo

CAS 883523-03-3

:

2,7-Bis[(12-bromododecyl)thio]-3,6-dimethoxynaphthalene

Description:
2,7-Bis[(12-bromododecyl)thio]-3,6-dimethoxynaphthalene is a synthetic organic compound characterized by its complex structure, which includes a naphthalene core substituted with two long-chain alkyl groups and methoxy groups. The presence of bromine atoms in the alkyl chains enhances its reactivity and potential for various applications, particularly in materials science and organic electronics. The thioether linkages contribute to the compound's stability and solubility in organic solvents. This compound is likely to exhibit interesting electronic properties due to the conjugated naphthalene system, making it a candidate for use in organic photovoltaic devices or as a building block in the synthesis of more complex materials. Additionally, the long alkyl chains may impart surfactant-like properties, influencing its behavior in solution and interactions with other materials. Overall, 2,7-Bis[(12-bromododecyl)thio]-3,6-dimethoxynaphthalene represents a versatile compound with potential applications in advanced chemical and material sciences.
Formula:C36H58Br2O2S2
InChI:InChI=1S/C36H58Br2O2S2/c1-39-33-27-31-28-34(40-2)36(42-26-22-18-14-10-6-4-8-12-16-20-24-38)30-32(31)29-35(33)41-25-21-17-13-9-5-3-7-11-15-19-23-37/h27-30H,3-26H2,1-2H3
InChI key:InChIKey=DRHSTALLYCIUIL-UHFFFAOYSA-N
SMILES:S(CCCCCCCCCCCCBr)C1=CC2=C(C=C(OC)C(SCCCCCCCCCCCCBr)=C2)C=C1OC
Synonyms:
  • Naphthalene, 2,7-bis[(12-bromododecyl)thio]-3,6-dimethoxy-
  • 2,7-Bis[(12-bromododecyl)thio]-3,6-dimethoxynaphthalene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.