CymitQuimica logo

CAS 883526-96-3

:

2-bromo-N-(thiophen-2-ylmethyl)acetamide

Description:
2-bromo-N-(thiophen-2-ylmethyl)acetamide is a chemical compound characterized by its unique structure, which includes a bromine atom, an acetamide functional group, and a thiophene ring. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions. The thiophene moiety contributes to the compound's aromatic properties and can influence its electronic characteristics, potentially enhancing its biological activity. This compound is likely to exhibit moderate solubility in organic solvents due to its polar acetamide group and non-polar thiophene ring. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with thiophene derivatives often show significant biological activity. Additionally, the presence of the bromine atom may facilitate further functionalization, allowing for the synthesis of more complex derivatives. Overall, 2-bromo-N-(thiophen-2-ylmethyl)acetamide represents a versatile scaffold for chemical exploration and development.
Formula:C7H8BrNOS
InChI:InChI=1/C7H8BrNOS/c8-4-7(10)9-5-6-2-1-3-11-6/h1-3H,4-5H2,(H,9,10)
SMILES:c1cc(CN=C(CBr)O)sc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.