CymitQuimica logo

CAS 883528-73-2

:

Methyl (2Z)-3-amino-2-pentenoate

Description:
Methyl (2Z)-3-amino-2-pentenoate, with the CAS number 883528-73-2, is an organic compound characterized by its amino acid-like structure. It features a pentenoate backbone, which includes a double bond and an ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the amino group (-NH2) indicates that it can participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions, making it valuable in the synthesis of more complex molecules. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. Its solubility in polar solvents like water and alcohols suggests it can be used in biological systems or as a reagent in chemical reactions. Additionally, the (2Z) configuration denotes the specific geometric arrangement of the substituents around the double bond, which can influence its biological activity and interaction with other molecules. Overall, Methyl (2Z)-3-amino-2-pentenoate is a versatile compound with potential applications in pharmaceuticals and organic chemistry.
Formula:C6H11NO2
InChI:InChI=1S/C6H11NO2/c1-3-5(7)4-6(8)9-2/h4H,3,7H2,1-2H3/b5-4-
InChI key:InChIKey=NKSXDMWAVIOSTD-PLNGDYQASA-N
SMILES:C(=C(/CC)\N)\C(OC)=O
Synonyms:
  • (2Z)-3-Amino-2-pentenoic acid methyl ester
  • Methyl (2Z)-3-amino-2-pentenoate
  • (Z)-Methyl 3-amino-2-pentenoate
  • 3-Amino-4-methyl crotonic acid methylester
  • 2-Pentenoic acid, 3-amino-, methyl ester, (2Z)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.