CAS 88353-05-3

5-(2,6-Dimethyl-1,5-heptadien-1-yl)-2,4-imidazolidinedione

Description:

5-(2,6-Dimethyl-1,5-heptadien-1-yl)-2,4-imidazolidinedione, with the CAS number 88353-05-3, is a chemical compound characterized by its unique structure that includes an imidazolidinedione moiety and a long carbon chain with multiple double bonds. This compound typically exhibits properties associated with both its hydrophobic hydrocarbon tail and the polar imidazolidinedione functional group, which can influence its solubility and reactivity. It may participate in various chemical reactions, including those typical of conjugated systems, such as electrophilic additions or polymerization. The presence of the dimethyl groups suggests potential steric hindrance, which can affect its reactivity and interaction with other molecules. Additionally, compounds of this nature may have applications in organic synthesis, pharmaceuticals, or as intermediates in the production of more complex chemical entities. Understanding its stability, reactivity, and potential biological activity would require further investigation, including studies on its physical properties and behavior under different conditions.

Formula: C₁₂H₁₈N₂O₂

InChI: InChI=1S/C12H18N2O2/c1-8(2)5-4-6-9(3)7-10-11(15)14-12(16)13-10/h5,7,10H,4,6H2,1-3H3,(H2,13,14,15,16)

InChI key: InChIKey=YBSOWXAPCOCDPK-UHFFFAOYSA-N

SMILES: C(=C(CCC=C(C)C)C)C1C(=O)NC(=O)N1

Synonyms:

• 2,4-Imidazolidinedione, 5-(2,6-dimethyl-1,5-heptadienyl)-
• 5-(2,6-Dimethyl-1,5-heptadien-1-yl)-2,4-imidazolidinedione
• 2,4-Imidazolidinedione, 5-(2,6-dimethyl-1,5-heptadien-1-yl)-

2,4-Imidazolidinedione, 5-(2,6-dimethyl-1,5-heptadienyl)-

CAS: 88353-05-3

Formula: C₁₂H₁₈N₂O₂

Molecular weight: 222.2835

Ref: IN-DA0046SQ