CAS 883531-07-5
:1-(5-fluoro-1H-indol-2-yl)methanamine
Description:
1-(5-Fluoro-1H-indol-2-yl)methanamine, with the CAS number 883531-07-5, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 5-position of the indole ring contributes to its unique properties, potentially influencing its biological activity and chemical reactivity. The methanamine group attached to the indole provides basic amine characteristics, making the compound capable of forming hydrogen bonds and participating in various chemical reactions. This compound may exhibit interesting pharmacological properties, as indole derivatives are often studied for their roles in medicinal chemistry, particularly in the development of pharmaceuticals. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used. Overall, 1-(5-fluoro-1H-indol-2-yl)methanamine represents a valuable compound for research in organic chemistry and drug development.
Formula:C9H9FN2
InChI:InChI=1/C9H9FN2/c10-7-1-2-9-6(3-7)4-8(5-11)12-9/h1-4,12H,5,11H2
SMILES:c1cc2c(cc1F)cc(CN)[nH]2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
