CAS 883531-30-4

β-[2-(1-Methyl-2-piperidinyl)ethoxy]benzenepropanamine

Description:

β-[2-(1-Methyl-2-piperidinyl)ethoxy]benzenepropanamine, with the CAS number 883531-30-4, is a chemical compound that belongs to the class of amines. It features a complex structure that includes a benzene ring, an ethoxy group, and a piperidine moiety, which contributes to its potential biological activity. The presence of the piperidine ring suggests that this compound may exhibit properties relevant to pharmacology, possibly interacting with neurotransmitter systems. Its molecular structure indicates that it may have lipophilic characteristics, allowing it to traverse biological membranes effectively. The compound's specific properties, such as solubility, stability, and reactivity, would depend on its functional groups and overall molecular configuration. Additionally, the presence of the methyl group on the piperidine ring may influence its steric and electronic properties, potentially affecting its binding affinity to biological targets. Overall, while detailed studies would be necessary to elucidate its full characteristics and applications, β-[2-(1-Methyl-2-piperidinyl)ethoxy]benzenepropanamine represents a compound of interest in medicinal chemistry and pharmacological research.

Formula: C₁₇H₂₈N₂O

InChI: InChI=1S/C17H28N2O/c1-19-11-6-5-9-16(19)10-12-20-17(14-18)13-15-7-3-2-4-8-15/h2-4,7-8,16-17H,5-6,9-14,18H2,1H3

InChI key: InChIKey=JURREHZWAKPHTH-UHFFFAOYSA-N

SMILES: C(C(OCCC1N(C)CCCC1)CN)C2=CC=CC=C2

Synonyms:

• Benzenepropanamine, β-[2-(1-methyl-2-piperidinyl)ethoxy]-
• β-[2-(1-Methyl-2-piperidinyl)ethoxy]benzenepropanamine