CymitQuimica logo

CAS 883535-67-9

:

4-(2-Cyclopentylethoxy)piperidine

Description:
4-(2-Cyclopentylethoxy)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing five carbon atoms and one nitrogen atom. The compound features a cyclopentylethoxy group attached to the piperidine nitrogen, contributing to its unique structural and functional properties. This substitution can influence the compound's solubility, lipophilicity, and potential biological activity. Typically, compounds like this may exhibit properties relevant to medicinal chemistry, including potential applications in pharmacology or as intermediates in organic synthesis. The presence of the cyclopentyl group may enhance interactions with biological targets, making it of interest in drug development. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions or modifications, depending on the functional groups present. As with many organic compounds, its stability, reactivity, and interactions with other substances would be influenced by environmental conditions such as temperature and pH.
Formula:C12H23NO
InChI:InChI=1S/C12H23NO/c1-2-4-11(3-1)7-10-14-12-5-8-13-9-6-12/h11-13H,1-10H2
InChI key:InChIKey=VBZYMXJGOWNFHH-UHFFFAOYSA-N
SMILES:C(COC1CCNCC1)C2CCCC2
Synonyms:
  • Piperidine, 4-(2-cyclopentylethoxy)-
  • 4-(2-Cyclopentylethoxy)piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.