
CAS 883537-86-8
:2,5-Dimethyl-1-(4-pyridinylmethyl)-1H-pyrrole-3-carboxaldehyde
Description:
2,5-Dimethyl-1-(4-pyridinylmethyl)-1H-pyrrole-3-carboxaldehyde is an organic compound characterized by its complex structure, which includes a pyrrole ring, a pyridine moiety, and an aldehyde functional group. This compound typically exhibits a molecular formula that reflects its diverse functional groups, contributing to its reactivity and potential applications in various fields, including medicinal chemistry and organic synthesis. The presence of the aldehyde group suggests that it can participate in nucleophilic addition reactions, while the pyrrole and pyridine rings may contribute to its aromatic properties and potential biological activity. Additionally, the dimethyl substitutions on the pyrrole ring can influence its steric and electronic properties, affecting its solubility and interaction with other molecules. Overall, this compound's unique structural features make it a subject of interest for research into new pharmaceuticals or agrochemicals, as well as for studies on its chemical behavior in different environments.
Formula:C13H14N2O
InChI:InChI=1S/C13H14N2O/c1-10-7-13(9-16)11(2)15(10)8-12-3-5-14-6-4-12/h3-7,9H,8H2,1-2H3
InChI key:InChIKey=SNYOVWYDEUFGLX-UHFFFAOYSA-N
SMILES:C(N1C(C)=C(C=O)C=C1C)C=2C=CN=CC2
Synonyms:- 1H-Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-(4-pyridinylmethyl)-
- 2,5-Dimethyl-1-(4-pyridinylmethyl)-1H-pyrrole-3-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.