CAS 883538-02-1

1-ethoxy-3-methyl-butan-2-amine

Description:

1-Ethoxy-3-methyl-butan-2-amine, identified by its CAS number 883538-02-1, is an organic compound characterized by its amine functional group, which contributes to its basicity and potential reactivity. This compound features a butane backbone with an ethoxy group and a methyl substituent, influencing its solubility and physical properties. Typically, amines like this one exhibit moderate polarity due to the presence of nitrogen, which can engage in hydrogen bonding. The ethoxy group enhances its solubility in organic solvents while potentially limiting solubility in water. The presence of the methyl group can affect steric hindrance and reactivity, making it a candidate for various chemical reactions, including alkylation and acylation. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including temperature, pH, and the presence of other reagents.

Formula: C₇H₁₇NO

InChI: InChI=1/C7H17NO/c1-4-9-5-7(8)6(2)3/h6-7H,4-5,8H2,1-3H3

SMILES: CCOCC(C(C)C)N

1-Ethoxy-3-methylbutan-2-amine

CAS: 883538-02-1

Versatile small molecule scaffold

Formula: C₇H₁₇NO

Purity: Min. 95%

Molecular weight: 131.22 g/mol

Ref: 3D-IKB53802