CAS 883539-33-1

(2-ethyl-1H-imidazol-1-yl)acetic acid

Description:

(2-Ethyl-1H-imidazol-1-yl)acetic acid is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an ethyl group attached to the imidazole ring, contributing to its unique properties. The presence of the acetic acid functional group provides acidic characteristics, allowing it to participate in various chemical reactions, including esterification and amidation. The compound is likely to exhibit moderate solubility in polar solvents due to the presence of both the imidazole and carboxylic acid functionalities. Its potential applications may include use in pharmaceuticals, as a building block in organic synthesis, or as a ligand in coordination chemistry. The imidazole moiety is known for its biological activity, which may suggest potential pharmacological properties. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through empirical studies and literature review.

Formula: C₇H₁₀N₂O₂

InChI: InChI=1/C7H10N2O2/c1-2-6-8-3-4-9(6)5-7(10)11/h3-4H,2,5H2,1H3,(H,10,11)

SMILES: CCc1nccn1CC(=O)O

Synonyms:

• 1H-imidazole-1-acetic acid, 2-ethyl-

(2-Ethyl-imidazol-1-yl)-acetic acid

CAS: 883539-33-1

Formula: C₇H₁₀N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 154.1665

Ref: IN-DA0046SF

(2-Ethyl-1H-imidazol-1-yl)acetic acid

CAS: 883539-33-1

(2-Ethyl-1H-imidazol-1-yl)acetic acid

Purity: 95%

Molecular weight: 154.17g/mol

Ref: 54-OR905479

(2-Ethyl-imidazol-1-yl)-acetic acid

CAS: 883539-33-1

Formula: C₇H₁₀N₂O₂

Purity: 95.0%

Molecular weight: 154.169

Ref: 10-F059117