CAS 883539-49-9
:[(1-ethyl-1H-indol-3-yl)sulfanyl]acetic acid
Description:
[(1-ethyl-1H-indol-3-yl)sulfanyl]acetic acid is a chemical compound characterized by its unique structure, which includes an indole ring substituted with an ethyl group and a sulfanyl (thioether) functional group linked to an acetic acid moiety. This compound features a sulfur atom that contributes to its reactivity and potential biological activity. The presence of the indole structure suggests possible interactions with biological systems, as indoles are known for their roles in various pharmacological activities. The acetic acid component may impart acidic properties, influencing solubility and reactivity in different environments. This compound may be of interest in medicinal chemistry and drug development due to its potential therapeutic applications. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. As with many organic compounds, safety and handling precautions should be observed, particularly when dealing with sulfur-containing compounds, which can have distinct odors and reactivity profiles.
Formula:C12H13NO2S
InChI:InChI=1/C12H13NO2S/c1-2-13-7-11(16-8-12(14)15)9-5-3-4-6-10(9)13/h3-7H,2,8H2,1H3,(H,14,15)
SMILES:CCn1cc(c2ccccc12)SCC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.