CAS 883541-44-4

Benzaldehyde, 2-methoxy-5-(methoxymethyl)-

Description:

Benzaldehyde, 2-methoxy-5-(methoxymethyl)-, with the CAS number 883541-44-4, is an organic compound that belongs to the class of aromatic aldehydes. It features a benzene ring substituted with methoxy groups and a methoxymethyl group, contributing to its unique chemical properties. This compound is typically characterized by its pleasant, almond-like odor, which is common among benzaldehyde derivatives. It is a colorless to pale yellow liquid at room temperature and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water due to its hydrophobic nature. The presence of multiple methoxy groups enhances its reactivity and can influence its behavior in various chemical reactions, such as electrophilic aromatic substitution. Additionally, benzaldehyde derivatives are often utilized in the synthesis of fragrances, flavoring agents, and as intermediates in organic synthesis. Safety considerations should be taken into account, as it may pose health risks if inhaled or ingested, necessitating proper handling and storage protocols.

Formula: C₁₀H₁₂O₃

InChI: InChI=1S/C10H12O3/c1-12-7-8-3-4-10(13-2)9(5-8)6-11/h3-6H,7H2,1-2H3

InChI key: InChIKey=RASYJFLRBZVXKN-UHFFFAOYSA-N

SMILES: C(=O)C1=C(OC)C=CC(COC)=C1

Synonyms:

• Benzaldehyde, 2-methoxy-5-(methoxymethyl)-