CAS 883541-64-8
:3-(4-Fluorophenyl)-1,2,4-oxadiazole-5-butanoic acid
Description:
3-(4-Fluorophenyl)-1,2,4-oxadiazole-5-butanoic acid is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of the 4-fluorophenyl group indicates that a fluorine atom is substituted on a phenyl ring, contributing to the compound's unique electronic properties and potential biological activity. The butanoic acid moiety suggests that the compound has a carboxylic acid functional group, which can participate in hydrogen bonding and influence solubility and reactivity. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for various interactions with biological targets, potentially leading to applications in drug development. Additionally, the presence of the fluorine atom can enhance metabolic stability and lipophilicity, which are important factors in the design of pharmaceuticals. Overall, 3-(4-Fluorophenyl)-1,2,4-oxadiazole-5-butanoic acid is a compound of interest for further research in both synthetic and medicinal chemistry.
Formula:C12H11FN2O3
InChI:InChI=1S/C12H11FN2O3/c13-9-6-4-8(5-7-9)12-14-10(18-15-12)2-1-3-11(16)17/h4-7H,1-3H2,(H,16,17)
InChI key:InChIKey=ADZWCBJOLPWMPT-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)C1=NC(=NO1)C2=CC=C(F)C=C2
Synonyms:- 1,2,4-Oxadiazole-5-butanoic acid, 3-(4-fluorophenyl)-
- 3-(4-Fluorophenyl)-1,2,4-oxadiazole-5-butanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.