CAS 883541-83-1

2-[(3-Fluorophenoxy)methyl]pyrrolidine

Description:

2-[(3-Fluorophenoxy)methyl]pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a 3-fluorophenoxy group. The presence of the fluorine atom in the phenoxy moiety can influence the compound's electronic properties and biological activity. This substance is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which is common for compounds with aromatic and heterocyclic structures. The compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular interactions can be influenced by the fluorine substituent, which can enhance lipophilicity and alter binding affinities to biological targets. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, 2-[(3-Fluorophenoxy)methyl]pyrrolidine represents a valuable compound for research in various chemical and pharmaceutical applications.

Formula: C₁₁H₁₄FNO

InChI: InChI=1S/C11H14FNO/c12-9-3-1-5-11(7-9)14-8-10-4-2-6-13-10/h1,3,5,7,10,13H,2,4,6,8H2

InChI key: InChIKey=CZMLRTHMBKPCPS-UHFFFAOYSA-N

SMILES: O(CC1CCCN1)C2=CC(F)=CC=C2

Synonyms:

• 2-[(3-Fluorophenoxy)methyl]pyrrolidine
• Pyrrolidine, 2-[(3-fluorophenoxy)methyl]-