CymitQuimica logo

CAS 883542-33-4

:

1-(furan-2-ylmethyl)piperidine-3-carboxylic acid

Description:
1-(Furan-2-ylmethyl)piperidine-3-carboxylic acid is a chemical compound characterized by its unique structure, which includes a piperidine ring substituted with a furan moiety and a carboxylic acid functional group. The presence of the furan ring contributes to its aromatic properties, while the piperidine ring provides a cyclic amine structure that can participate in various chemical reactions. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, which can engage in hydrogen bonding. Additionally, the furan and piperidine components may influence its biological activity, making it of interest in medicinal chemistry. The compound's molecular interactions could be significant in drug design, particularly in targeting specific biological pathways. Overall, 1-(furan-2-ylmethyl)piperidine-3-carboxylic acid represents a versatile scaffold for further chemical modifications and potential therapeutic applications.
Formula:C11H15NO3
InChI:InChI=1/C11H15NO3/c13-11(14)9-3-1-5-12(7-9)8-10-4-2-6-15-10/h2,4,6,9H,1,3,5,7-8H2,(H,13,14)
SMILES:C1CC(CN(C1)Cc1ccco1)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.