CAS 883542-90-3
:(3-methylpiperidin-1-yl)acetic acid
Description:
(3-Methylpiperidin-1-yl)acetic acid is an organic compound characterized by its piperidine ring structure, which features a methyl group at the 3-position and an acetic acid functional group. This compound is classified as an amino acid derivative due to the presence of the carboxylic acid group. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the piperidine ring contributes to its basicity and potential for forming hydrogen bonds, which can influence its solubility in polar solvents like water and alcohols. The compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its molecular structure allows for various chemical reactions, including esterification and amidation, which can be utilized in synthetic organic chemistry. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken.
Formula:C8H15NO2
InChI:InChI=1/C8H15NO2/c1-7-3-2-4-9(5-7)6-8(10)11/h7H,2-6H2,1H3,(H,10,11)
SMILES:CC1CCCN(C1)CC(=O)O
Synonyms:- 1-Piperidineacetic Acid, 3-Methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
