CymitQuimica logo

CAS 883543-32-6

:

5-[(4-methylpiperidin-1-yl)methyl]furan-2-carboxylic acid

Description:
5-[(4-Methylpiperidin-1-yl)methyl]furan-2-carboxylic acid is a chemical compound characterized by its unique structure, which includes a furan ring and a carboxylic acid functional group. The presence of the 4-methylpiperidine moiety contributes to its potential biological activity, as piperidine derivatives are often found in various pharmaceuticals. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, which can engage in hydrogen bonding. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound may also display specific reactivity patterns typical of carboxylic acids, such as esterification or amidation. Additionally, the furan ring can participate in electrophilic aromatic substitution reactions. Overall, the characteristics of this compound, including its functional groups and structural features, position it as a candidate for further research in drug development and synthetic chemistry.
Formula:C12H17NO3
InChI:InChI=1/C12H17NO3/c1-9-4-6-13(7-5-9)8-10-2-3-11(16-10)12(14)15/h2-3,9H,4-8H2,1H3,(H,14,15)
SMILES:CC1CCN(CC1)Cc1ccc(C(=O)O)o1
Synonyms:
  • 2-Furancarboxylic Acid, 5-[(4-Methyl-1-Piperidinyl)Methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.