CAS 883543-35-9

2-Methoxy-N-methyl-1-propanamine

Description:

2-Methoxy-N-methyl-1-propanamine, identified by its CAS number 883543-35-9, is an organic compound characterized by its amine functional group and methoxy substituent. This compound features a propanamine backbone, which contributes to its basicity and potential reactivity. The presence of the methoxy group enhances its solubility in organic solvents and may influence its interaction with biological systems. Typically, compounds like this can exhibit moderate volatility and may have a low to moderate molecular weight, which can affect their physical properties such as boiling and melting points. Additionally, due to the amine group, 2-Methoxy-N-methyl-1-propanamine may participate in hydrogen bonding, impacting its solubility in water and other polar solvents. Its potential applications could span various fields, including pharmaceuticals and agrochemicals, where such amines are often utilized as intermediates or active ingredients. Safety and handling considerations are essential, as with many amines, due to potential irritant properties and the need for proper storage to prevent degradation.

Formula: C₅H₁₃NO

InChI: InChI=1S/C5H13NO/c1-5(7-3)4-6-2/h5-6H,4H2,1-3H3

InChI key: InChIKey=ARJYMGOQJFRJEF-UHFFFAOYSA-N

SMILES: C(CNC)(OC)C

Synonyms:

• 2-Methoxy-N-methyl-1-propanamine
• 1-Propanamine, 2-methoxy-N-methyl-