CAS 883543-40-6

α-Ethyl-4-methyl-1-piperidineethanamine

Description:

α-Ethyl-4-methyl-1-piperidineethanamine, identified by its CAS number 883543-40-6, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and is substituted with an ethyl group and a methyl group, contributing to its unique properties. The presence of the amine functional group indicates that it can participate in hydrogen bonding, which may influence its solubility and reactivity. Generally, compounds of this nature can exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The structural characteristics, such as the specific arrangement of substituents on the piperidine ring, can significantly affect the compound's pharmacokinetics and pharmacodynamics. Additionally, the compound's stability, melting point, boiling point, and solubility in various solvents would be important for practical applications, although specific values would need to be referenced from experimental data or literature. Overall, α-Ethyl-4-methyl-1-piperidineethanamine represents a class of compounds with potential utility in various chemical and biological contexts.

Formula: C₁₀H₂₂N₂

InChI: InChI=1S/C10H22N2/c1-3-10(11)8-12-6-4-9(2)5-7-12/h9-10H,3-8,11H2,1-2H3

InChI key: InChIKey=KUVAPQHVIWXCEO-UHFFFAOYSA-N

SMILES: C(C(CC)N)N1CCC(C)CC1

Synonyms:

• α-Ethyl-4-methyl-1-piperidineethanamine
• 1-Piperidineethanamine, α-ethyl-4-methyl-