CymitQuimica logo

CAS 883543-54-2

:

2-(3-Methyl-1-piperidinyl)-5-pyrimidinecarboxaldehyde

Description:
2-(3-Methyl-1-piperidinyl)-5-pyrimidinecarboxaldehyde is a chemical compound characterized by its unique structure, which includes a pyrimidine ring and a piperidine moiety. The presence of the aldehyde functional group contributes to its reactivity, making it a potential intermediate in organic synthesis. This compound typically exhibits moderate solubility in polar solvents due to the presence of both hydrophilic and hydrophobic regions in its structure. Its molecular framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with piperidine and pyrimidine derivatives are often associated with biological activity. Additionally, the methyl group on the piperidine ring may influence the compound's steric and electronic properties, affecting its interaction with biological targets. Overall, 2-(3-Methyl-1-piperidinyl)-5-pyrimidinecarboxaldehyde is of interest for further research in drug design and synthesis due to its structural features and potential reactivity.
Formula:C11H15N3O
InChI:InChI=1S/C11H15N3O/c1-9-3-2-4-14(7-9)11-12-5-10(8-15)6-13-11/h5-6,8-9H,2-4,7H2,1H3
InChI key:InChIKey=YGWJFOFMSYFRAC-UHFFFAOYSA-N
SMILES:CC1CN(CCC1)C=2N=CC(C=O)=CN2
Synonyms:
  • 5-Pyrimidinecarboxaldehyde, 2-(3-methyl-1-piperidinyl)-
  • 2-(3-Methyl-1-piperidinyl)-5-pyrimidinecarboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.