
CAS 883544-09-0
:α-[[4-Methyl-2-(2-propen-1-yl)phenoxy]methyl]-1-piperazineethanol
Description:
α-[[4-Methyl-2-(2-propen-1-yl)phenoxy]methyl]-1-piperazineethanol, identified by its CAS number 883544-09-0, is a chemical compound characterized by its complex structure, which includes a piperazine moiety and a phenoxy group. This compound typically exhibits properties associated with both amines and alcohols, suggesting potential solubility in polar solvents. Its structure indicates the presence of functional groups that may contribute to its reactivity, including the piperazine ring, which is known for its ability to form hydrogen bonds and participate in various chemical reactions. The presence of the propenyl group may also impart unique reactivity, potentially allowing for further chemical modifications. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could influence biological activity. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise details.
Formula:C17H26N2O2
InChI:InChI=1S/C17H26N2O2/c1-3-4-15-11-14(2)5-6-17(15)21-13-16(20)12-19-9-7-18-8-10-19/h3,5-6,11,16,18,20H,1,4,7-10,12-13H2,2H3
InChI key:InChIKey=ZKAOFRNFIUCJQW-UHFFFAOYSA-N
SMILES:O(CC(CN1CCNCC1)O)C2=C(CC=C)C=C(C)C=C2
Synonyms:- 1-Piperazineethanol, α-[[4-methyl-2-(2-propenyl)phenoxy]methyl]-
- 1-Piperazineethanol, α-[[4-methyl-2-(2-propen-1-yl)phenoxy]methyl]-
- α-[[4-Methyl-2-(2-propen-1-yl)phenoxy]methyl]-1-piperazineethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.