CAS 883544-22-7

3-(5-amino-1H-benzimidazol-1-yl)propan-1-ol

Description:

3-(5-amino-1H-benzimidazol-1-yl)propan-1-ol, identified by its CAS number 883544-22-7, is a chemical compound characterized by its structural features that include a benzimidazole moiety and a propanol side chain. This compound typically exhibits properties associated with both amines and alcohols, such as the ability to form hydrogen bonds due to the presence of the hydroxyl (-OH) group and the amino (-NH2) group. It is likely to be soluble in polar solvents, reflecting the hydrophilic nature of its functional groups. The benzimidazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may also exhibit basic properties due to the amino group, which can participate in protonation reactions. Overall, its unique structure suggests potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting various biological pathways. Further studies would be necessary to fully elucidate its chemical behavior and potential applications.

Formula: C₁₀H₁₃N₃O

InChI: InChI=1/C10H13N3O/c11-8-2-3-10-9(6-8)12-7-13(10)4-1-5-14/h2-3,6-7,14H,1,4-5,11H2

SMILES: C(Cn1cnc2cc(ccc12)N)CO

Synonyms:

• 3-(5-Amino-benzoimidazol-1-yl)-propan-1-ol

3-(5-Amino-1h-benzimidazol-1-yl)-1-propanol

CAS: 883544-22-7

Formula: C₁₀H₁₃N₃O

Molecular weight: 191.2297

Ref: IN-DA0045A0

3-(5-amino-1H-benzimidazol-1-yl)-1-propanol

CAS: 883544-22-7

Formula: C₁₀H₁₃N₃O

Purity: 95.0%

Molecular weight: 191.234

Ref: 10-F311130