CymitQuimica logo

CAS 883544-74-9

:

1-[(Tetrahydro-2-furanyl)methoxy]-2-propanamine

Description:
1-[(Tetrahydro-2-furanyl)methoxy]-2-propanamine, identified by its CAS number 883544-74-9, is an organic compound characterized by its unique molecular structure that includes a tetrahydrofuran ring and a propanamine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the tetrahydrofuran ring contributes to its potential as a solvent or reactant in various chemical reactions. Additionally, the methoxy group enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 1-[(Tetrahydro-2-furanyl)methoxy]-2-propanamine is a versatile compound with potential applications in pharmaceuticals and organic synthesis, although specific applications would depend on further research into its properties and interactions.
Formula:C8H17NO2
InChI:InChI=1S/C8H17NO2/c1-7(9)5-10-6-8-3-2-4-11-8/h7-8H,2-6,9H2,1H3
InChI key:InChIKey=LLSWRLZOQCLMJS-UHFFFAOYSA-N
SMILES:C(OCC(C)N)C1CCCO1
Synonyms:
  • 1-[(Tetrahydro-2-furanyl)methoxy]-2-propanamine
  • 2-Propanamine, 1-[(tetrahydro-2-furanyl)methoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.