CAS 883544-97-6
:ethyl 4-(aminomethyl)-2,5-dimethylfuran-3-carboxylate
Description:
Ethyl 4-(aminomethyl)-2,5-dimethylfuran-3-carboxylate is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents. The presence of the aminomethyl group indicates that it has an amine functional group, which can participate in hydrogen bonding and may enhance its reactivity in various chemical reactions. The two methyl groups on the furan ring provide additional steric hindrance and influence the compound's physical properties, such as boiling point and melting point. Ethyl 4-(aminomethyl)-2,5-dimethylfuran-3-carboxylate may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and reactivity would depend on the functional groups present and the overall molecular structure, which can be explored further through synthetic chemistry and biological assays. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C10H15NO3
InChI:InChI=1/C10H15NO3/c1-4-13-10(12)9-7(3)14-6(2)8(9)5-11/h4-5,11H2,1-3H3
SMILES:CCOC(=O)c1c(C)oc(C)c1CN
Synonyms:- 3-Furancarboxylic Acid, 4-(Aminomethyl)-2,5-Dimethyl-, Ethyl Ester
- 4-Aminomethyl-2,5-dimethyl-furan-3-carboxylic acid ethyl ester
- Ethyl 4-(aminomethyl)-2,5-dimethyl-3-furoate
- Furane-3-carboxylic acid, 4-aminomethyl-2,5-dimethyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
