CAS 883545-53-7

4-(4-Morpholinyl)-4-piperidinecarboxylic acid

Description:

4-(4-Morpholinyl)-4-piperidinecarboxylic acid, identified by its CAS number 883545-53-7, is a chemical compound characterized by its unique structure that includes a piperidine ring and a morpholine moiety. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in polar solvents like water and methanol, owing to the presence of both carboxylic acid and nitrogen-containing heterocycles. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The presence of the morpholine and piperidine groups may contribute to its pharmacological activity, potentially influencing its binding affinity and selectivity for various receptors. Additionally, the compound's stability and reactivity can be influenced by the functional groups attached to the piperidine and morpholine rings, making it a subject of interest in synthetic organic chemistry and drug design.

Formula: C₁₀H₁₈N₂O₃

InChI: InChI=1S/C10H18N2O3/c13-9(14)10(1-3-11-4-2-10)12-5-7-15-8-6-12/h11H,1-8H2,(H,13,14)

InChI key: InChIKey=NQBWOCCOOPTMIO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(CCNCC1)N2CCOCC2

Synonyms:

• 4-(4-Morpholinyl)-4-piperidinecarboxylic acid
• 4-Piperidinecarboxylic acid, 4-(4-morpholinyl)-