
CAS 883545-66-2
:4-[2-(4-Methyl-2-nitrophenyl)diazenyl]morpholine
Description:
4-[2-(4-Methyl-2-nitrophenyl)diazenyl]morpholine, identified by its CAS number 883545-66-2, is an organic compound characterized by its azo structure, which features a diazenyl group (-N=N-) linking two aromatic systems. This compound contains a morpholine ring, contributing to its heterocyclic nature, and a nitrophenyl moiety that imparts distinct electronic properties. The presence of the methyl and nitro substituents on the aromatic ring influences its reactivity and solubility, making it potentially useful in various applications, including dyes, pigments, and as a chemical intermediate in organic synthesis. The compound's structure suggests it may exhibit interesting optical properties, and its azo linkage can be involved in various chemical reactions, such as azo coupling. Additionally, the morpholine ring may enhance its solubility in polar solvents, which is advantageous for certain applications. Overall, this compound's unique structural features and functional groups make it a subject of interest in both synthetic and applied chemistry.
Formula:C11H14N4O3
InChI:InChI=1S/C11H14N4O3/c1-9-2-3-10(11(8-9)15(16)17)12-13-14-4-6-18-7-5-14/h2-3,8H,4-7H2,1H3
InChI key:InChIKey=AMTBAUIHFFQYHK-UHFFFAOYSA-N
SMILES:N(=NN1CCOCC1)C2=C(N(=O)=O)C=C(C)C=C2
Synonyms:- Morpholine, 4-[(4-methyl-2-nitrophenyl)azo]-
- 4-[2-(4-Methyl-2-nitrophenyl)diazenyl]morpholine
- Morpholine, 4-[2-(4-methyl-2-nitrophenyl)diazenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
