CymitQuimica logo

CAS 883545-92-4

:

5-Phenyl-1,2,4-oxadiazole-3-methanamine

Description:
5-Phenyl-1,2,4-oxadiazole-3-methanamine is an organic compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a phenyl group attached to the oxadiazole ring, contributing to its aromatic properties and potential for various chemical interactions. The methanamine functional group introduces an amine (-NH2) moiety, which can participate in hydrogen bonding and nucleophilic reactions. This compound may exhibit interesting biological activities due to the presence of both the oxadiazole and amine functionalities, making it a candidate for pharmaceutical research. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Additionally, the presence of the phenyl group may enhance its lipophilicity, influencing its bioavailability and interaction with biological targets. Overall, 5-Phenyl-1,2,4-oxadiazole-3-methanamine is a compound of interest in medicinal chemistry and materials science, warranting further investigation into its properties and potential applications.
Formula:C9H9N3O
InChI:InChI=1S/C9H9N3O/c10-6-8-11-9(13-12-8)7-4-2-1-3-5-7/h1-5H,6,10H2
InChI key:InChIKey=JEFIFQRLLDJFSE-UHFFFAOYSA-N
SMILES:C(N)C=1N=C(ON1)C2=CC=CC=C2
Synonyms:
  • (5-Phenyl-1,2,4-oxadiazol-3-yl)methanamine
  • 5-Phenyl-1,2,4-oxadiazole-3-methanamine
  • 1,2,4-Oxadiazole-3-methanamine, 5-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.