
CAS 883546-01-8
:3-Methoxy-2-[2-(4-methyl-1-piperidinyl)ethoxy]benzaldehyde
Description:
3-Methoxy-2-[2-(4-methyl-1-piperidinyl)ethoxy]benzaldehyde, with the CAS number 883546-01-8, is an organic compound characterized by its complex structure that includes a methoxy group, a benzaldehyde moiety, and a piperidine derivative. This compound typically exhibits properties associated with aromatic aldehydes, such as a distinct odor and potential reactivity in electrophilic aromatic substitution reactions. The presence of the methoxy group enhances its solubility in organic solvents and may influence its electronic properties, making it a potential candidate for various chemical reactions. The piperidine ring contributes to its basicity and may affect its interaction with biological systems, suggesting potential pharmacological applications. Additionally, the compound's structure indicates it may participate in hydrogen bonding due to the presence of the aldehyde functional group, which can influence its physical properties, such as melting and boiling points. Overall, 3-Methoxy-2-[2-(4-methyl-1-piperidinyl)ethoxy]benzaldehyde is a versatile compound with potential applications in medicinal chemistry and organic synthesis.
Formula:C16H23NO3
InChI:InChI=1S/C16H23NO3/c1-13-6-8-17(9-7-13)10-11-20-16-14(12-18)4-3-5-15(16)19-2/h3-5,12-13H,6-11H2,1-2H3
InChI key:InChIKey=UMZBMKKCMSEYMV-UHFFFAOYSA-N
SMILES:O(CCN1CCC(C)CC1)C2=C(C=O)C=CC=C2OC
Synonyms:- Benzaldehyde, 3-methoxy-2-[2-(4-methyl-1-piperidinyl)ethoxy]-
- 3-Methoxy-2-[2-(4-methyl-1-piperidinyl)ethoxy]benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.