CymitQuimica logo

CAS 883546-13-2

:

3-methoxy-2-(2-morpholin-4-ylethoxy)benzaldehyde

Description:
3-Methoxy-2-(2-morpholin-4-ylethoxy)benzaldehyde is an organic compound characterized by its aromatic structure, featuring a methoxy group and a morpholine-derived substituent. The presence of the aldehyde functional group indicates that it can participate in various chemical reactions, such as oxidation and condensation. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic ring and the polar nature of the morpholine and methoxy groups. The morpholine moiety may impart unique properties, such as potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests it could serve as a building block for synthesizing more complex molecules or as a ligand in coordination chemistry. Its specific reactivity and applications would depend on the functional groups present and their spatial arrangement, which can influence its behavior in chemical reactions and interactions with other substances. Overall, 3-methoxy-2-(2-morpholin-4-ylethoxy)benzaldehyde represents a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C14H19NO4
InChI:InChI=1/C14H19NO4/c1-17-13-4-2-3-12(11-16)14(13)19-10-7-15-5-8-18-9-6-15/h2-4,11H,5-10H2,1H3
SMILES:COc1cccc(C=O)c1OCCN1CCOCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.