CymitQuimica logo

CAS 883546-16-5

:

2-Bromo-5-chloro-1,3-difluorobenzene

Description:
2-Bromo-5-chloro-1,3-difluorobenzene is an aromatic halogenated compound characterized by the presence of two fluorine atoms, a bromine atom, and a chlorine atom attached to a benzene ring. This compound features a difluorobenzene structure, where the fluorine substituents are positioned at the 1 and 3 positions, while the bromine and chlorine are located at the 2 and 5 positions, respectively. The presence of multiple halogens contributes to its chemical reactivity, making it useful in various synthetic applications, including pharmaceuticals and agrochemicals. The compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. Its physical properties, such as boiling point and melting point, are influenced by the halogen substituents, which also affect its polarity and solubility in organic solvents. Additionally, 2-Bromo-5-chloro-1,3-difluorobenzene may exhibit interesting electronic properties due to the electron-withdrawing nature of the halogens, impacting its behavior in chemical reactions and interactions with other substances.
Formula:C6H2BrClF2
InChI:InChI=1/C6H2BrClF2/c7-6-4(9)1-3(8)2-5(6)10/h1-2H
InChI key:OUMNGNRBHZGAMH-UHFFFAOYSA-N
SMILES:c1c(cc(c(c1F)Br)F)Cl
Synonyms:
  • Benzene, 2-bromo-5-chloro-1,3-difluoro-
  • 4-Bromo-1-chloro-3,5-difluorobenzene
  • 1-Bromo-4-chloro-2,6-difluorobenzene
Found 4 products.