CAS 883546-29-0

1′-Propyl[1,4′-bipiperidine]-3-carboxylic acid

Description:

1′-Propyl[1,4′-bipiperidine]-3-carboxylic acid is a chemical compound characterized by its bipiperidine structure, which consists of two piperidine rings connected by a carbon chain. This compound features a propyl group and a carboxylic acid functional group, contributing to its potential as a bioactive molecule. The presence of the carboxylic acid group suggests that it can participate in various chemical reactions, including esterification and amidation. The bipiperidine framework may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's structure may influence its solubility, stability, and interaction with biological targets. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature typically exhibit moderate to high polarity due to the presence of the carboxylic acid group. Overall, 1′-Propyl[1,4′-bipiperidine]-3-carboxylic acid represents a unique structure that could be explored for various applications in pharmaceuticals and organic synthesis.

Formula: C₁₄H₂₆N₂O₂

InChI: InChI=1S/C14H26N2O2/c1-2-7-15-9-5-13(6-10-15)16-8-3-4-12(11-16)14(17)18/h12-13H,2-11H2,1H3,(H,17,18)

InChI key: InChIKey=DZRSRWZRQUUFNV-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CN(CCC1)C2CCN(CCC)CC2

Synonyms:

• [1,4′-Bipiperidine]-3-carboxylic acid, 1′-propyl-
• 1′-Propyl[1,4′-bipiperidine]-3-carboxylic acid