CAS 883546-54-1

3-(2-Methoxyphenyl)-1,2,4-oxadiazole-5-butanoic acid

Description:

3-(2-Methoxyphenyl)-1,2,4-oxadiazole-5-butanoic acid is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. The presence of the methoxyphenyl group enhances its lipophilicity, potentially influencing its interaction with biological membranes. This compound features a butanoic acid moiety, which may impart acidic properties and facilitate interactions with various biological targets. The oxadiazole ring is known for its stability and ability to participate in various chemical reactions, making it a valuable scaffold in medicinal chemistry. Additionally, the compound may exhibit interesting pharmacological properties, including anti-inflammatory or antimicrobial activities, although specific biological data would be necessary to confirm these effects. Its molecular structure suggests potential applications in drug development, particularly in the fields of pharmaceuticals and agrochemicals. As with many synthetic compounds, safety and handling precautions should be observed, and further studies are essential to fully understand its properties and potential uses.

Formula: C₁₃H₁₄N₂O₄

InChI: InChI=1S/C13H14N2O4/c1-18-10-6-3-2-5-9(10)13-14-11(19-15-13)7-4-8-12(16)17/h2-3,5-6H,4,7-8H2,1H3,(H,16,17)

InChI key: InChIKey=IHBJNJBBDFKJHE-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=2N=C(CCCC(O)=O)ON2)C=CC=C1

Synonyms:

• 1,2,4-Oxadiazole-5-Butanoic Acid, 3-(2-Methoxyphenyl)-
• 3-(2-Methoxyphenyl)-1,2,4-oxadiazole-5-butanoic acid

4-[3-(2-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]butanoic acid

CAS: 883546-54-1

Formula: C₁₃H₁₄N₂O₄

Molecular weight: 262.2613

Ref: IN-DA0046S5