CymitQuimica logo

CAS 883546-66-5

:

(2-chloro-6-fluorobenzyl)hydrazine

Description:
(2-Chloro-6-fluorobenzyl)hydrazine is an organic compound characterized by the presence of a hydrazine functional group attached to a benzyl moiety that is further substituted with chlorine and fluorine atoms. This compound features a benzene ring with a chlorine atom at the second position and a fluorine atom at the sixth position, contributing to its unique reactivity and potential biological activity. The hydrazine group (-NH-NH2) is known for its ability to form various derivatives and can participate in a range of chemical reactions, including oxidation and condensation. The presence of halogens (chlorine and fluorine) can influence the compound's physical properties, such as solubility and volatility, as well as its reactivity in synthetic pathways. This compound may be of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for more complex molecules. Safety precautions should be observed when handling this compound, as hydrazines can be toxic and potentially carcinogenic.
Formula:C7H8ClFN2
InChI:InChI=1/C7H8ClFN2/c8-6-2-1-3-7(9)5(6)4-11-10/h1-3,11H,4,10H2
SMILES:c1cc(c(CNN)c(c1)F)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.