CAS 883546-85-8
:3-Methoxy-2-[2-(1-piperidinyl)ethoxy]benzaldehyde
Description:
3-Methoxy-2-[2-(1-piperidinyl)ethoxy]benzaldehyde, with the CAS number 883546-85-8, is an organic compound characterized by its complex structure, which includes a methoxy group, a benzaldehyde moiety, and a piperidine substituent. This compound typically exhibits properties associated with aromatic aldehydes, such as a distinct odor and reactivity towards nucleophiles due to the presence of the aldehyde functional group. The methoxy group contributes to its electron-donating characteristics, potentially influencing its reactivity and solubility in organic solvents. The piperidine ring enhances its biological activity, making it of interest in medicinal chemistry for potential pharmacological applications. The compound's solubility is generally higher in polar organic solvents, and it may participate in various chemical reactions, including oxidation and reduction, due to the functional groups present. Overall, 3-Methoxy-2-[2-(1-piperidinyl)ethoxy]benzaldehyde is a versatile compound with potential applications in drug development and organic synthesis.
Formula:C15H21NO3
InChI:InChI=1S/C15H21NO3/c1-18-14-7-5-6-13(12-17)15(14)19-11-10-16-8-3-2-4-9-16/h5-7,12H,2-4,8-11H2,1H3
InChI key:InChIKey=VGHFJKQNISXLGR-UHFFFAOYSA-N
SMILES:O(CCN1CCCCC1)C2=C(C=O)C=CC=C2OC
Synonyms:- Benzaldehyde, 3-methoxy-2-[2-(1-piperidinyl)ethoxy]-
- 3-Methoxy-2-[2-(1-piperidinyl)ethoxy]benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.