
CAS 883546-94-9
:3-[[(3-Chloro-1H-indol-2-yl)methyl]amino]-1-propanol
Description:
3-[[(3-Chloro-1H-indol-2-yl)methyl]amino]-1-propanol, with the CAS number 883546-94-9, is a chemical compound characterized by its unique structure that includes an indole moiety, a chloro substituent, and a propanol group. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the hydroxyl group and the ability to form hydrogen bonds. The presence of the chloro group may impart specific reactivity and influence the compound's biological activity. Indole derivatives are often studied for their pharmacological properties, including potential roles in medicinal chemistry. The compound's molecular structure suggests it may interact with biological targets, making it of interest in drug development. Additionally, its synthesis and stability under various conditions would be relevant for practical applications. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with potential therapeutic implications.
Formula:C12H15ClN2O
InChI:InChI=1S/C12H15ClN2O/c13-12-9-4-1-2-5-10(9)15-11(12)8-14-6-3-7-16/h1-2,4-5,14-16H,3,6-8H2
InChI key:InChIKey=PQSBOCSNFDFQOI-UHFFFAOYSA-N
SMILES:ClC=1C=2C(NC1CNCCCO)=CC=CC2
Synonyms:- 1-Propanol, 3-[[(3-chloro-1H-indol-2-yl)methyl]amino]-
- 3-[[(3-Chloro-1H-indol-2-yl)methyl]amino]-1-propanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.