CAS 883547-15-7
:4,5,6,7-Tetrahydro-1H-indazole-3-methanamine
Description:
4,5,6,7-Tetrahydro-1H-indazole-3-methanamine, with the CAS number 883547-15-7, is a chemical compound characterized by its bicyclic structure, which includes an indazole ring system. This compound features a tetrahydro configuration, indicating that it contains a saturated ring with four carbon atoms and two nitrogen atoms in the indazole framework. The presence of a methanamine group contributes to its potential as a building block in organic synthesis and medicinal chemistry. Typically, compounds like this may exhibit biological activity, making them of interest in pharmacological research. The molecular structure suggests that it may participate in hydrogen bonding due to the amine group, influencing its solubility and reactivity. Additionally, the compound's stereochemistry can affect its interaction with biological targets, which is crucial for drug design. Overall, 4,5,6,7-Tetrahydro-1H-indazole-3-methanamine represents a versatile scaffold for further chemical modifications and applications in various fields, including medicinal chemistry and materials science.
Formula:C8H13N3
InChI:InChI=1S/C8H13N3/c9-5-8-6-3-1-2-4-7(6)10-11-8/h1-5,9H2,(H,10,11)
InChI key:InChIKey=UNDOPZXTORKIIL-UHFFFAOYSA-N
SMILES:C(N)C=1C2=C(NN1)CCCC2
Synonyms:- 3-Aminomethyl-4,5,6,7-tetrahydroindazole
- 4,5,6,7-Tetrahydro-1H-indazole-3-methanamine
- 1H-Indazole-3-methanamine, 4,5,6,7-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
