CymitQuimica logo

CAS 883547-18-0

:

2-Chloro-1-[1-(2-methoxyethyl)-2-methyl-1H-indol-3-yl]ethanone

Description:
2-Chloro-1-[1-(2-methoxyethyl)-2-methyl-1H-indol-3-yl]ethanone, with the CAS number 883547-18-0, is a synthetic organic compound characterized by its complex structure, which includes an indole moiety and a chloroacetyl group. This compound typically exhibits properties associated with indole derivatives, such as potential biological activity, including anti-inflammatory and anticancer effects. The presence of the methoxyethyl group may enhance its solubility and bioavailability. As a chlorinated compound, it may also exhibit unique reactivity patterns, making it of interest in medicinal chemistry and drug development. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Its specific applications and effects would depend on further empirical studies, including pharmacological evaluations and toxicity assessments. Overall, 2-Chloro-1-[1-(2-methoxyethyl)-2-methyl-1H-indol-3-yl]ethanone represents a class of compounds that could be valuable in research and therapeutic contexts.
Formula:C14H16ClNO2
InChI:InChI=1S/C14H16ClNO2/c1-10-14(13(17)9-15)11-5-3-4-6-12(11)16(10)7-8-18-2/h3-6H,7-9H2,1-2H3
InChI key:InChIKey=LNRSTBUATZADPY-UHFFFAOYSA-N
SMILES:C(COC)N1C=2C(C(C(CCl)=O)=C1C)=CC=CC2
Synonyms:
  • Ethanone, 2-chloro-1-[1-(2-methoxyethyl)-2-methyl-1H-indol-3-yl]-
  • 2-Chloro-1-[1-(2-methoxyethyl)-2-methyl-1H-indol-3-yl]ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.