
CAS 883547-24-8
:3-Chloro-4-(3-methoxy-3-methylbutoxy)benzenamine
Description:
3-Chloro-4-(3-methoxy-3-methylbutoxy)benzenamine is an organic compound characterized by its aromatic amine structure, which includes a chloro substituent and a methoxy-alkyl ether group. The presence of the chloro group at the 3-position of the benzene ring contributes to its reactivity and potential applications in various chemical reactions, such as nucleophilic substitutions. The 4-position is substituted with a 3-methoxy-3-methylbutoxy group, which enhances the compound's lipophilicity and may influence its biological activity. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic characteristics. Its molecular structure suggests potential uses in pharmaceuticals or agrochemicals, where such functional groups can impart specific properties. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental concerns. Overall, 3-Chloro-4-(3-methoxy-3-methylbutoxy)benzenamine represents a complex organic molecule with diverse chemical properties and potential applications.
Formula:C12H18ClNO2
InChI:InChI=1S/C12H18ClNO2/c1-12(2,15-3)6-7-16-11-5-4-9(14)8-10(11)13/h4-5,8H,6-7,14H2,1-3H3
InChI key:InChIKey=APFXPMBDYXPDIY-UHFFFAOYSA-N
SMILES:O(CCC(OC)(C)C)C1=C(Cl)C=C(N)C=C1
Synonyms:- 3-Chloro-4-(3-methoxy-3-methylbutoxy)benzenamine
- Benzenamine, 3-chloro-4-(3-methoxy-3-methylbutoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.