CymitQuimica logo

CAS 883547-38-4

:

1-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]ethanamine

Description:
1-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]ethanamine, with the CAS number 883547-38-4, is a chemical compound characterized by its unique structure, which includes an oxadiazole ring and an ethanamine moiety. The presence of the 2-methylphenyl group contributes to its aromatic characteristics, potentially influencing its solubility and reactivity. This compound may exhibit biological activity due to the functional groups present, making it of interest in medicinal chemistry and drug development. The oxadiazole ring is known for its stability and can participate in various chemical reactions, including nucleophilic substitutions. Additionally, the amine group can engage in hydrogen bonding, affecting the compound's interaction with biological targets. Overall, the compound's properties, such as melting point, solubility, and reactivity, would depend on its specific molecular interactions and the environment in which it is studied. Further research would be necessary to fully elucidate its potential applications and biological effects.
Formula:C11H13N3O
InChI:InChI=1/C11H13N3O/c1-7-5-3-4-6-9(7)10-13-11(8(2)12)15-14-10/h3-6,8H,12H2,1-2H3
SMILES:Cc1ccccc1c1nc(C(C)N)on1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.