CymitQuimica logo

CAS 883547-44-2

:

1-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]ethanamine

Description:
1-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]ethanamine, with the CAS number 883547-44-2, is a chemical compound characterized by its unique structure that includes an oxadiazole ring and an ethanamine moiety. The presence of the 3-methylphenyl group contributes to its aromatic properties, potentially influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its oxadiazole component is known for its role in various pharmacological applications, including antimicrobial and anti-inflammatory properties. The amine functional group suggests potential for hydrogen bonding and interaction with biological targets. Additionally, the compound's stability, reactivity, and solubility in different solvents can vary based on environmental conditions and the presence of substituents. Overall, 1-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]ethanamine represents a class of compounds that may have significant implications in research and therapeutic contexts.
Formula:C11H13N3O
InChI:InChI=1/C11H13N3O/c1-7-4-3-5-9(6-7)10-13-11(8(2)12)15-14-10/h3-6,8H,12H2,1-2H3
SMILES:Cc1cccc(c1)c1nc(C(C)N)on1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.