
CAS 883547-99-7
:2-[(2-Methylphenoxy)methyl]pyrrolidine
Description:
2-[(2-Methylphenoxy)methyl]pyrrolidine is an organic compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The structure features a 2-methylphenoxy group attached to a methylene bridge, linking it to the pyrrolidine. This compound is likely to exhibit properties typical of both aromatic and aliphatic compounds, including moderate polarity due to the presence of the ether functional group from the phenoxy moiety. The pyrrolidine ring contributes to its potential as a basic amine, which may influence its reactivity and interactions with other chemical species. Additionally, the presence of the methyl group on the phenyl ring can affect the compound's steric and electronic properties, potentially enhancing its lipophilicity. Such characteristics may render it useful in various applications, including medicinal chemistry, where it could serve as a scaffold for drug development or as a ligand in coordination chemistry. However, specific physical and chemical properties such as solubility, melting point, and boiling point would require empirical measurement or detailed computational analysis for precise characterization.
Formula:C12H17NO
InChI:InChI=1S/C12H17NO/c1-10-5-2-3-7-12(10)14-9-11-6-4-8-13-11/h2-3,5,7,11,13H,4,6,8-9H2,1H3
InChI key:InChIKey=HCSMFAWBFQFVBB-UHFFFAOYSA-N
SMILES:O(CC1CCCN1)C2=C(C)C=CC=C2
Synonyms:- Pyrrolidine, 2-[(2-methylphenoxy)methyl]-
- 2-[(2-Methylphenoxy)methyl]pyrrolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.