CAS 883548-05-8

1-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanamine

Description:

1-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanamine is a chemical compound characterized by its unique structure, which includes an oxadiazole ring and a chlorophenyl group. The presence of the oxadiazole moiety contributes to its potential biological activity, as oxadiazoles are often associated with various pharmacological properties. The compound features a methanamine functional group, which can participate in hydrogen bonding and may influence its solubility and reactivity. The chlorine atom on the phenyl ring can enhance lipophilicity and may also affect the compound's interaction with biological targets. This substance is typically studied for its potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, 1-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanamine represents a class of compounds that may hold promise in drug discovery and development.

Formula: C₉H₈ClN₃O

InChI: InChI=1/C9H8ClN3O/c10-7-4-2-1-3-6(7)9-12-8(5-11)14-13-9/h1-4H,5,11H2

SMILES: c1ccc(c(c1)c1nc(CN)on1)Cl

Synonyms:

• 1,2,4-Oxadiazole-5-Methanamine, 3-(2-Chlorophenyl)-

1-[3-(2-CHLOROPHENYL)-1,2,4-OXADIAZOL-5-YL]METHANAMINE

CAS: 883548-05-8

Formula: C₉H₈ClN₃O

Purity: 95%

Color and Shape: Liquid

Molecular weight: 209.6323

Ref: IN-DA0045RX

[3-(2-Chlorophenyl)-1,2,4-oxadiazol-5-yl]methanamine

CAS: 883548-05-8

[3-(2-Chlorophenyl)-1,2,4-oxadiazol-5-yl]methanamine

Purity: 95%

Molecular weight: 209.63g/mol

Ref: 54-OR76382

{[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl}amine

CAS: 883548-05-8

Formula: C₉H₈ClN₃O

Purity: 95%

Molecular weight: 209.63

Ref: 10-F315735