CAS 883548-16-1
:1-(4-chlorophenyl)-1-pyridin-4-ylmethanamine
Description:
1-(4-chlorophenyl)-1-pyridin-4-ylmethanamine, with the CAS number 883548-16-1, is a chemical compound characterized by its unique structure, which includes a pyridine ring and a chlorophenyl group. This compound typically exhibits properties associated with both aromatic and amine functionalities, contributing to its potential reactivity and biological activity. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to the presence of polar amine and aromatic groups. The chlorophenyl moiety may impart specific electronic properties, influencing its interaction with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as it could exhibit activity against certain biological pathways or diseases. Its synthesis and characterization would involve standard organic chemistry techniques, and safety precautions should be taken due to the presence of chlorine, which can pose environmental and health risks. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C12H11ClN2
InChI:InChI=1/C12H11ClN2/c13-11-3-1-9(2-4-11)12(14)10-5-7-15-8-6-10/h1-8,12H,14H2
SMILES:c1cc(ccc1C(c1ccncc1)N)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
