CAS 883550-05-8

4-(1,4-dioxa-8-azaspiro[4.5]dec-8-yl)-4-oxobutanoic acid

Description:

4-(1,4-dioxa-8-azaspiro[4.5]dec-8-yl)-4-oxobutanoic acid, identified by its CAS number 883550-05-8, is a chemical compound characterized by its unique spirocyclic structure, which incorporates both a dioxane and an azaspiro moiety. This compound features a butanoic acid functional group, contributing to its potential acidity and reactivity. The presence of the dioxane ring suggests that it may exhibit interesting solubility properties, while the azaspiro structure can influence its steric and electronic characteristics. Such compounds often have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. The specific arrangement of atoms and functional groups in this molecule may also impart unique properties, such as enhanced stability or selectivity in biological systems. Overall, the combination of these structural features makes it a compound of interest for further research and potential applications in various fields, including drug design and materials science.

Formula: C₁₁H₁₇NO₅

InChI: InChI=1/C11H17NO5/c13-9(1-2-10(14)15)12-5-3-11(4-6-12)16-7-8-17-11/h1-8H2,(H,14,15)

SMILES: C(CC(=O)O)C(=O)N1CCC2(CC1)OCCO2

Synonyms:

• 1,4-Dioxa-8-Azaspiro[4.5]Decane-8-Butanoic Acid, Gamma-Oxo-

4-(1,4-Dioxa-8-azaspiro[4.5]dec-8-yl)-4-oxobutanoic acid

CAS: 883550-05-8

Formula: C₁₁H₁₇NO₅

Molecular weight: 243.2564

Ref: IN-DA00898N