
CAS 883555-12-2
:N-Acetyl-N-(2-fluorophenyl)acetamide
Description:
N-Acetyl-N-(2-fluorophenyl)acetamide, with the CAS number 883555-12-2, is an organic compound characterized by its acetamide functional group and the presence of a fluorophenyl substituent. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, reflecting its moderate polarity. The presence of the fluorine atom in the 2-position of the phenyl ring can influence its electronic properties, potentially enhancing its reactivity and biological activity. N-Acetyl-N-(2-fluorophenyl)acetamide may be of interest in medicinal chemistry due to its structural features, which could contribute to specific pharmacological effects. Its synthesis generally involves acylation reactions, and it may be utilized in various applications, including drug development and as an intermediate in organic synthesis. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C10H10FNO2
InChI:InChI=1S/C10H10FNO2/c1-7(13)12(8(2)14)10-6-4-3-5-9(10)11/h3-6H,1-2H3
InChI key:InChIKey=ATGOKUDTNWOJRK-UHFFFAOYSA-N
SMILES:N(C(C)=O)(C(C)=O)C1=C(F)C=CC=C1
Synonyms:- Acetamide, N-acetyl-N-(2-fluorophenyl)-
- N-Acetyl-N-(2-fluorophenyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
