CAS 88357-31-7
:N-(Dichloromethylene)glycine ethyl ester
Description:
N-(Dichloromethylene)glycine ethyl ester, with the CAS number 88357-31-7, is a chemical compound characterized by its structure, which includes a dichloromethylene group attached to a glycine derivative. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity due to the presence of the dichloromethylene moiety, which can participate in various chemical reactions, including nucleophilic substitutions. The ethyl ester group contributes to its solubility in organic solvents, making it useful in synthetic organic chemistry. Additionally, this compound may exhibit biological activity, which could be of interest in pharmaceutical research. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, N-(Dichloromethylene)glycine ethyl ester is a versatile compound with applications in both research and industry, particularly in the synthesis of other chemical entities.
Formula:C5H7Cl2NO2
InChI:InChI=1S/C5H7Cl2NO2/c1-2-10-4(9)3-8-5(6)7/h2-3H2,1H3
InChI key:InChIKey=KAMCHTKSYCCCQK-UHFFFAOYSA-N
SMILES:C(CN=C(Cl)Cl)(OCC)=O
Synonyms:- Glycine, N-(dichloromethylene)-, ethyl ester
- N-(Dichloromethylene)glycine ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
